C17H23N7OS — CID 89091240
N-[5-[(1Z)-1-[[amino(diethylamino)methylidene]amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide (PubChem CID 89091240) has the molecular formula C17H23N7OS and a molecular weight of 373.49 g/mol. Its IUPAC name is N-[5-[(1Z)-1-[[amino(diethylamino)methylidene]amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[5-[(1Z)-1-[[amino(diethylamino)methylidene]amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 89091240 |
| Molecular Formula | C17H23N7OS |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[5-[(1Z)-1-[[amino(diethylamino)methylidene]amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
| SMILES | C=C/C=C(\N=C(/N)N(CC)CC)c1sc(NC(=O)n2ccnc2)nc1C |
| InChI | InChI=1S/C17H23N7OS/c1-5-8-13(21-15(18)23(6-2)7-3)14-12(4)20-16(26-14)22-17(25)24-10-9-19-11-24/h5,8-11H,1,6-7H2,2-4H3,(H2,18,21)(H,20,22,25)/b13-8- |
| InChIKey | DENOAXLITCNXGO-JYRVWZFOSA-N |
| XLogP | 2.91 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|