C14H13F3N6OS — CID 89091266
N-[5-[(1Z)-1-[(1-amino-2,2,2-trifluoroethylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide (PubChem CID 89091266) has the molecular formula C14H13F3N6OS and a molecular weight of 370.36 g/mol. Its IUPAC name is N-[5-[(1Z)-1-[(1-amino-2,2,2-trifluoroethylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[5-[(1Z)-1-[(1-amino-2,2,2-trifluoroethylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 89091266 |
| Molecular Formula | C14H13F3N6OS |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[5-[(1Z)-1-[(1-amino-2,2,2-trifluoroethylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
| SMILES | C=C/C=C(\N=C(/N)C(F)(F)F)c1sc(NC(=O)n2ccnc2)nc1C |
| InChI | InChI=1S/C14H13F3N6OS/c1-3-4-9(21-11(18)14(15,16)17)10-8(2)20-12(25-10)22-13(24)23-6-5-19-7-23/h3-7H,1H2,2H3,(H2,18,21)(H,20,22,24)/b9-4- |
| InChIKey | ABBLHDXANQDIAJ-WTKPLQERSA-N |
| XLogP | 3.17 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|