C18H24N6OS — CID 89091300
N-[5-[(1Z)-1-[(1-amino-2,2-dimethylpropylidene)amino]-3-methylbuta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide (PubChem CID 89091300) has the molecular formula C18H24N6OS and a molecular weight of 372.50 g/mol. Its IUPAC name is N-[5-[(1Z)-1-[(1-amino-2,2-dimethylpropylidene)amino]-3-methylbuta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[5-[(1Z)-1-[(1-amino-2,2-dimethylpropylidene)amino]-3-methylbuta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 89091300 |
| Molecular Formula | C18H24N6OS |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[5-[(1Z)-1-[(1-amino-2,2-dimethylpropylidene)amino]-3-methylbuta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
| SMILES | C=C(C)/C=C(\N=C(/N)C(C)(C)C)c1sc(NC(=O)n2ccnc2)nc1C |
| InChI | InChI=1S/C18H24N6OS/c1-11(2)9-13(22-15(19)18(4,5)6)14-12(3)21-16(26-14)23-17(25)24-8-7-20-10-24/h7-10H,1H2,2-6H3,(H2,19,22)(H,21,23,25)/b13-9- |
| InChIKey | NRYFQJVYOUKCPI-LCYFTJDESA-N |
| XLogP | 4.05 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|