C17H19F3N6OS — CID 89091352
N-[5-[(1Z)-1-[(1-amino-3,3,3-trifluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide (PubChem CID 89091352) has the molecular formula C17H19F3N6OS and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[5-[(1Z)-1-[(1-amino-3,3,3-trifluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[5-[(1Z)-1-[(1-amino-3,3,3-trifluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 89091352 |
| Molecular Formula | C17H19F3N6OS |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[5-[(1Z)-1-[(1-amino-3,3,3-trifluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
| SMILES | C=C/C=C(\N=C(/N)C(C)(C)C(F)(F)F)c1sc(NC(=O)n2ccnc2)nc1C |
| InChI | InChI=1S/C17H19F3N6OS/c1-5-6-11(24-13(21)16(3,4)17(18,19)20)12-10(2)23-14(28-12)25-15(27)26-8-7-22-9-26/h5-9H,1H2,2-4H3,(H2,21,24)(H,23,25,27)/b11-6- |
| InChIKey | UAYUTSVUNREXGL-WDZFZDKYSA-N |
| XLogP | 4.20 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|