C14H22N4S — CID 89091364
N'-[(1Z)-1-(2-amino-4-methyl-1,3-thiazol-5-yl)-3-methylbuta-1,3-dienyl]-2,2-dimethylpropanimidamide (PubChem CID 89091364) has the molecular formula C14H22N4S and a molecular weight of 278.43 g/mol. Its IUPAC name is N'-[(1Z)-1-(2-amino-4-methyl-1,3-thiazol-5-yl)-3-methylbuta-1,3-dienyl]-2,2-dimethylpropanimidamide.
| Compound Name | N'-[(1Z)-1-(2-amino-4-methyl-1,3-thiazol-5-yl)-3-methylbuta-1,3-dienyl]-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 89091364 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N'-[(1Z)-1-(2-amino-4-methyl-1,3-thiazol-5-yl)-3-methylbuta-1,3-dienyl]-2,2-dimethylpropanimidamide |
| SMILES | C=C(C)/C=C(\N=C(/N)C(C)(C)C)c1sc(N)nc1C |
| InChI | InChI=1S/C14H22N4S/c1-8(2)7-10(18-12(15)14(4,5)6)11-9(3)17-13(16)19-11/h7H,1H2,2-6H3,(H2,15,18)(H2,16,17)/b10-7- |
| InChIKey | GZFFVSCGOBAJOD-YFHOEESVSA-N |
| XLogP | 3.35 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|