C25H24ClF2N3O2 — CID 89091551
N-[4-[(1S)-3-chloro-4-hydroxycyclohexyl]-3-pyridinyl]-6-(3-ethyl-2,6-difluorophenyl)pyridine-2-carboxamide (PubChem CID 89091551) has the molecular formula C25H24ClF2N3O2 and a molecular weight of 471.94 g/mol. Its IUPAC name is N-[4-[(1S)-3-chloro-4-hydroxycyclohexyl]-3-pyridinyl]-6-(3-ethyl-2,6-difluorophenyl)pyridine-2-carboxamide.
| Compound Name | N-[4-[(1S)-3-chloro-4-hydroxycyclohexyl]-3-pyridinyl]-6-(3-ethyl-2,6-difluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89091551 |
| Molecular Formula | C25H24ClF2N3O2 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[4-[(1S)-3-chloro-4-hydroxycyclohexyl]-3-pyridinyl]-6-(3-ethyl-2,6-difluorophenyl)pyridine-2-carboxamide |
| SMILES | CCc1ccc(F)c(-c2cccc(C(=O)Nc3cnccc3[C@H]3CCC(O)C(Cl)C3)n2)c1F |
| InChI | InChI=1S/C25H24ClF2N3O2/c1-2-14-6-8-18(27)23(24(14)28)19-4-3-5-20(30-19)25(33)31-21-13-29-11-10-16(21)15-7-9-22(32)17(26)12-15/h3-6,8,10-11,13,15,17,22,32H,2,7,9,12H2,1H3,(H,31,33)/t15-,17?,22?/m0/s1 |
| InChIKey | BRYJXSLCDAXSHL-JUTLFCHVSA-N |
| XLogP | 5.47 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|