C6H10N2O — CID 89091612
(3Z,5Z)-4,6-diaminohexa-1,3,5-trien-3-ol (PubChem CID 89091612) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is (3Z,5Z)-4,6-diaminohexa-1,3,5-trien-3-ol.
| Compound Name | (3Z,5Z)-4,6-diaminohexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 89091612 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (3Z,5Z)-4,6-diaminohexa-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(N)\C=C/N |
| InChI | InChI=1S/C6H10N2O/c1-2-6(9)5(8)3-4-7/h2-4,9H,1,7-8H2/b4-3-,6-5- |
| InChIKey | HBFJOWZPQAEFNW-OUPQRBNQSA-N |
| XLogP | 0.37 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|