C9H10ClF3N2O — CID 89092388
1-[3-(chloroamino)propyl]-3-(trifluoromethyl)pyridin-2-one (PubChem CID 89092388) has the molecular formula C9H10ClF3N2O and a molecular weight of 254.64 g/mol. Its IUPAC name is 1-[3-(chloroamino)propyl]-3-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[3-(chloroamino)propyl]-3-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 89092388 |
| Molecular Formula | C9H10ClF3N2O |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-[3-(chloroamino)propyl]-3-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1c(C(F)(F)F)cccn1CCCNCl |
| InChI | InChI=1S/C9H10ClF3N2O/c10-14-4-2-6-15-5-1-3-7(8(15)16)9(11,12)13/h1,3,5,14H,2,4,6H2 |
| InChIKey | UGSYCAQNIOYOHQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|