About [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate
[(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate (PubChem CID 89092593) has the molecular formula C12H17BrN2O6
and a molecular weight of 365.18 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate.
Molecular Properties
| Compound Name | [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate |
| PubChem CID | 89092593 |
| Molecular Formula | C12H17BrN2O6 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate |
| SMILES | CC(=O)OC[C@H](CCN1CC(Br)C(=O)NC1=O)OC(C)=O |
| InChI | InChI=1S/C12H17BrN2O6/c1-7(16)20-6-9(21-8(2)17)3-4-15-5-10(13)11(18)14-12(15)19/h9-10H,3-6H2,1-2H3,(H,14,18,19)/t9-,10?/m0/s1 |
| InChIKey | PXRINGFMGPZWLS-RGURZIINSA-N |
| XLogP | 0.19 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate?
The IUPAC name of [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate (CID 89092593) is [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate.
What is the SMILES notation for [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate?
The canonical SMILES for [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate is CC(=O)OC[C@H](CCN1CC(Br)C(=O)NC1=O)OC(C)=O.
What is the InChIKey of [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate?
The InChIKey is PXRINGFMGPZWLS-RGURZIINSA-N. The full InChI is InChI=1S/C12H17BrN2O6/c1-7(16)20-6-9(21-8(2)17)3-4-15-5-10(13)11(18)14-12(15)19/h9-10H,3-6H2,1-2H3,(H,14,18,19)/t9-,10?/m0/s1.
What are the key properties of [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate?
[(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate has a molecular weight of 365.18 g/mol, XLogP of 0.19, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-acetyloxy-4-(5-bromo-2,4-dioxo-1,3-diazinan-1-yl)butyl] acetate is sourced from PubChem (CID 89092593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).