C26H21ClN2O3S — CID 89092829
2-(2-chlorophenyl)-N-[[5-(3-formylphenyl)-2-methoxyphenyl]methyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 89092829) has the molecular formula C26H21ClN2O3S and a molecular weight of 476.99 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[[5-(3-formylphenyl)-2-methoxyphenyl]methyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[[5-(3-formylphenyl)-2-methoxyphenyl]methyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 89092829 |
| Molecular Formula | C26H21ClN2O3S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[[5-(3-formylphenyl)-2-methoxyphenyl]methyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(-c2cccc(C=O)c2)cc1CNC(=O)c1sc(-c2ccccc2Cl)nc1C |
| InChI | InChI=1S/C26H21ClN2O3S/c1-16-24(33-26(29-16)21-8-3-4-9-22(21)27)25(31)28-14-20-13-19(10-11-23(20)32-2)18-7-5-6-17(12-18)15-30/h3-13,15H,14H2,1-2H3,(H,28,31) |
| InChIKey | MMHIUWZNYCWCJG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|