About 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine
2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine (PubChem CID 89092900) has the molecular formula C17H14N4
and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine |
| PubChem CID | 89092900 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1Nc1ccnc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C17H14N4/c18-12-6-2-4-8-14(12)20-15-9-10-19-17-16(15)11-5-1-3-7-13(11)21-17/h1-10H,18H2,(H2,19,20,21) |
| InChIKey | CJPKVJKUJWEPDD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine?
The IUPAC name of 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine (CID 89092900) is 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine.
What is the SMILES notation for 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine?
The canonical SMILES for 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine is Nc1ccccc1Nc1ccnc2[nH]c3ccccc3c12.
What is the InChIKey of 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine?
The InChIKey is CJPKVJKUJWEPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4/c18-12-6-2-4-8-14(12)20-15-9-10-19-17-16(15)11-5-1-3-7-13(11)21-17/h1-10H,18H2,(H2,19,20,21).
What are the key properties of 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine?
2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine has a molecular weight of 274.33 g/mol, XLogP of 4.04, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(9H-pyrido[2,3-b]indol-4-yl)benzene-1,2-diamine is sourced from PubChem (CID 89092900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).