C35H45N2O7S2+ — CID 89093005
3-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-3-(4-oxobutyl)indol-2-ylidene]penta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid (PubChem CID 89093005) has the molecular formula C35H45N2O7S2+ and a molecular weight of 669.89 g/mol. Its IUPAC name is 3-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-3-(4-oxobutyl)indol-2-ylidene]penta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-3-(4-oxobutyl)indol-2-ylidene]penta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89093005 |
| Molecular Formula | C35H45N2O7S2+ |
| Molecular Weight | 669.89 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | 3-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-3-(4-oxobutyl)indol-2-ylidene]penta-1,3-dienyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C/C=C/C=C/C2=[N+](CCCS(=O)(=O)O)c3ccccc3C2(C)CCCS(=O)(=O)O)C(C)(CCCC=O)c2ccccc21 |
| InChI | InChI=1S/C35H44N2O7S2/c1-4-36-30-18-10-8-16-28(30)34(2,22-12-13-25-38)32(36)20-6-5-7-21-33-35(3,23-14-26-45(39,40)41)29-17-9-11-19-31(29)37(33)24-15-27-46(42,43)44/h5-11,16-21,25H,4,12-15,22-24,26-27H2,1-3H3,(H-,39,40,41,42,43,44)/p+1 |
| InChIKey | YJIVINUJOMSMCM-UHFFFAOYSA-O |
| XLogP | 6.15 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.89 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|