About N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide
N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide (PubChem CID 89093024) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide.
Molecular Properties
| Compound Name | N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide |
| PubChem CID | 89093024 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide |
| SMILES | C=CCOC(C(=O)NCC)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-6-8-14-9(11(3,4)5)10(13)12-7-2/h6,9H,1,7-8H2,2-5H3,(H,12,13) |
| InChIKey | PNZJENGYJQVYLW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide?
The IUPAC name of N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide (CID 89093024) is N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide.
What is the SMILES notation for N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide?
The canonical SMILES for N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide is C=CCOC(C(=O)NCC)C(C)(C)C.
What is the InChIKey of N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide?
The InChIKey is PNZJENGYJQVYLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-6-8-14-9(11(3,4)5)10(13)12-7-2/h6,9H,1,7-8H2,2-5H3,(H,12,13).
What are the key properties of N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide?
N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide has a molecular weight of 199.29 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,3-dimethyl-2-prop-2-enoxybutanamide is sourced from PubChem (CID 89093024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).