C19H29F2N — CID 89093088
(8R)-1-[(1Z)-buta-1,3-dienyl]-4-ethyl-6,8-difluoro-2,3,3,4-tetramethyl-6,7,8,8a-tetrahydro-1H-isoquinoline (PubChem CID 89093088) has the molecular formula C19H29F2N and a molecular weight of 309.44 g/mol. Its IUPAC name is (8R)-1-[(1Z)-buta-1,3-dienyl]-4-ethyl-6,8-difluoro-2,3,3,4-tetramethyl-6,7,8,8a-tetrahydro-1H-isoquinoline.
| Compound Name | (8R)-1-[(1Z)-buta-1,3-dienyl]-4-ethyl-6,8-difluoro-2,3,3,4-tetramethyl-6,7,8,8a-tetrahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 89093088 |
| Molecular Formula | C19H29F2N |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (8R)-1-[(1Z)-buta-1,3-dienyl]-4-ethyl-6,8-difluoro-2,3,3,4-tetramethyl-6,7,8,8a-tetrahydro-1H-isoquinoline |
| SMILES | C=C/C=C\C1C2C(=CC(F)C[C@H]2F)C(C)(CC)C(C)(C)N1C |
| InChI | InChI=1S/C19H29F2N/c1-7-9-10-16-17-14(11-13(20)12-15(17)21)19(5,8-2)18(3,4)22(16)6/h7,9-11,13,15-17H,1,8,12H2,2-6H3/b10-9-/t13?,15-,16?,17?,19?/m1/s1 |
| InChIKey | BWJXLGVWRDZMML-HMDPNMIYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|