C19H20N2O5 — CID 89093175
prop-1-en-2-yl N-[3-(6-morpholin-4-yl-4-oxopyran-2-yl)phenyl]carbamate (PubChem CID 89093175) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is prop-1-en-2-yl N-[3-(6-morpholin-4-yl-4-oxopyran-2-yl)phenyl]carbamate.
| Compound Name | prop-1-en-2-yl N-[3-(6-morpholin-4-yl-4-oxopyran-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 89093175 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | prop-1-en-2-yl N-[3-(6-morpholin-4-yl-4-oxopyran-2-yl)phenyl]carbamate |
| SMILES | C=C(C)OC(=O)Nc1cccc(-c2cc(=O)cc(N3CCOCC3)o2)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-13(2)25-19(23)20-15-5-3-4-14(10-15)17-11-16(22)12-18(26-17)21-6-8-24-9-7-21/h3-5,10-12H,1,6-9H2,2H3,(H,20,23) |
| InChIKey | GSZYSWWDNSYLEH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|