About prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate
prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate (PubChem CID 89093642) has the molecular formula C23H20FN3O4
and a molecular weight of 421.43 g/mol. Its IUPAC name is prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate.
Molecular Properties
| Compound Name | prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate |
| PubChem CID | 89093642 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate |
| SMILES | C=C(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(-c2ncc(CO)cc2F)cc1 |
| InChI | InChI=1S/C23H20FN3O4/c1-14(2)31-23(30)27-20-6-4-3-5-19(20)26-22(29)17-9-7-16(8-10-17)21-18(24)11-15(13-28)12-25-21/h3-12,28H,1,13H2,2H3,(H,26,29)(H,27,30) |
| InChIKey | UDYUMJPGMBOMEC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate?
The IUPAC name of prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate (CID 89093642) is prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate.
What is the SMILES notation for prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate?
The canonical SMILES for prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate is C=C(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(-c2ncc(CO)cc2F)cc1.
What is the InChIKey of prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate?
The InChIKey is UDYUMJPGMBOMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FN3O4/c1-14(2)31-23(30)27-20-6-4-3-5-19(20)26-22(29)17-9-7-16(8-10-17)21-18(24)11-15(13-28)12-25-21/h3-12,28H,1,13H2,2H3,(H,26,29)(H,27,30).
What are the key properties of prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate?
prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate has a molecular weight of 421.43 g/mol, XLogP of 4.71, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl N-[2-[[4-[3-fluoro-5-(hydroxymethyl)-2-pyridinyl]benzoyl]amino]phenyl]carbamate is sourced from PubChem (CID 89093642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).