C16H22N2O4S — CID 89093773
N-(3-aminopropyl)-N-(2-methylpropyl)-4-oxochromene-6-sulfonamide (PubChem CID 89093773) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-(2-methylpropyl)-4-oxochromene-6-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N-(2-methylpropyl)-4-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 89093773 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(3-aminopropyl)-N-(2-methylpropyl)-4-oxochromene-6-sulfonamide |
| SMILES | CC(C)CN(CCCN)S(=O)(=O)c1ccc2occc(=O)c2c1 |
| InChI | InChI=1S/C16H22N2O4S/c1-12(2)11-18(8-3-7-17)23(20,21)13-4-5-16-14(10-13)15(19)6-9-22-16/h4-6,9-10,12H,3,7-8,11,17H2,1-2H3 |
| InChIKey | AOVBFLOZNAGURI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |