About 9-methylidenefluorene-2,7-dicarbaldehyde
9-methylidenefluorene-2,7-dicarbaldehyde (PubChem CID 89093906) has the molecular formula C16H10O2
and a molecular weight of 234.25 g/mol. Its IUPAC name is 9-methylidenefluorene-2,7-dicarbaldehyde.
Molecular Properties
| Compound Name | 9-methylidenefluorene-2,7-dicarbaldehyde |
| PubChem CID | 89093906 |
| Molecular Formula | C16H10O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 9-methylidenefluorene-2,7-dicarbaldehyde |
| SMILES | C=C1c2cc(C=O)ccc2-c2ccc(C=O)cc21 |
| InChI | InChI=1S/C16H10O2/c1-10-15-6-11(8-17)2-4-13(15)14-5-3-12(9-18)7-16(10)14/h2-9H,1H2 |
| InChIKey | TXVHVOYMNFPHBV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9-methylidenefluorene-2,7-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylidenefluorene-2,7-dicarbaldehyde?
The IUPAC name of 9-methylidenefluorene-2,7-dicarbaldehyde (CID 89093906) is 9-methylidenefluorene-2,7-dicarbaldehyde.
What is the SMILES notation for 9-methylidenefluorene-2,7-dicarbaldehyde?
The canonical SMILES for 9-methylidenefluorene-2,7-dicarbaldehyde is C=C1c2cc(C=O)ccc2-c2ccc(C=O)cc21.
What is the InChIKey of 9-methylidenefluorene-2,7-dicarbaldehyde?
The InChIKey is TXVHVOYMNFPHBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O2/c1-10-15-6-11(8-17)2-4-13(15)14-5-3-12(9-18)7-16(10)14/h2-9H,1H2.
What are the key properties of 9-methylidenefluorene-2,7-dicarbaldehyde?
9-methylidenefluorene-2,7-dicarbaldehyde has a molecular weight of 234.25 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylidenefluorene-2,7-dicarbaldehyde is sourced from PubChem (CID 89093906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).