C14H20BrFO — CID 89093933
3-[(3E,5E)-5-(bromomethyl)hepta-3,5-dien-3-yl]oxy-6-fluorocyclohexene (PubChem CID 89093933) has the molecular formula C14H20BrFO and a molecular weight of 303.22 g/mol. Its IUPAC name is 3-[(3E,5E)-5-(bromomethyl)hepta-3,5-dien-3-yl]oxy-6-fluorocyclohexene.
| Compound Name | 3-[(3E,5E)-5-(bromomethyl)hepta-3,5-dien-3-yl]oxy-6-fluorocyclohexene |
|---|---|
| PubChem CID | 89093933 |
| Molecular Formula | C14H20BrFO |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-[(3E,5E)-5-(bromomethyl)hepta-3,5-dien-3-yl]oxy-6-fluorocyclohexene |
| SMILES | C/C=C(\C=C(/CC)OC1C=CC(F)CC1)CBr |
| InChI | InChI=1S/C14H20BrFO/c1-3-11(10-15)9-13(4-2)17-14-7-5-12(16)6-8-14/h3,5,7,9,12,14H,4,6,8,10H2,1-2H3/b11-3+,13-9+ |
| InChIKey | DBTYINAGKGPDIY-IKVDTSIJSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|