C17H36N2 — CID 89094043
(E)-N,N',N'-tritert-butyl-N-propan-2-ylethene-1,2-diamine (PubChem CID 89094043) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is (E)-N,N',N'-tritert-butyl-N-propan-2-ylethene-1,2-diamine.
| Compound Name | (E)-N,N',N'-tritert-butyl-N-propan-2-ylethene-1,2-diamine |
|---|---|
| PubChem CID | 89094043 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | (E)-N,N',N'-tritert-butyl-N-propan-2-ylethene-1,2-diamine |
| SMILES | CC(C)N(/C=C/N(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H36N2/c1-14(2)18(15(3,4)5)12-13-19(16(6,7)8)17(9,10)11/h12-14H,1-11H3/b13-12+ |
| InChIKey | WNYKTDJPWWJKDW-OUKQBFOZSA-N |
| XLogP | 4.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |