C11H20O2 — CID 89094333
1-ethyl-4-methylcycloheptane-1-carboxylic acid (PubChem CID 89094333) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-ethyl-4-methylcycloheptane-1-carboxylic acid.
| Compound Name | 1-ethyl-4-methylcycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 89094333 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 1-ethyl-4-methylcycloheptane-1-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCC(C)CC1 |
| InChI | InChI=1S/C11H20O2/c1-3-11(10(12)13)7-4-5-9(2)6-8-11/h9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | RQMTYWBVYJWQKW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |