About 3-nitrosocyclohexa-3,5-diene-1,2-diol
3-nitrosocyclohexa-3,5-diene-1,2-diol (PubChem CID 89094373) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 3-nitrosocyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 3-nitrosocyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 89094373 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 3-nitrosocyclohexa-3,5-diene-1,2-diol |
| SMILES | O=NC1=CC=CC(O)C1O |
| InChI | InChI=1S/C6H7NO3/c8-5-3-1-2-4(7-10)6(5)9/h1-3,5-6,8-9H |
| InChIKey | JPGBMKBFMRTXEZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-nitrosocyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrosocyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 3-nitrosocyclohexa-3,5-diene-1,2-diol (CID 89094373) is 3-nitrosocyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 3-nitrosocyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 3-nitrosocyclohexa-3,5-diene-1,2-diol is O=NC1=CC=CC(O)C1O.
What is the InChIKey of 3-nitrosocyclohexa-3,5-diene-1,2-diol?
The InChIKey is JPGBMKBFMRTXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-5-3-1-2-4(7-10)6(5)9/h1-3,5-6,8-9H.
What are the key properties of 3-nitrosocyclohexa-3,5-diene-1,2-diol?
3-nitrosocyclohexa-3,5-diene-1,2-diol has a molecular weight of 141.13 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrosocyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 89094373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).