C23H25N3O3S — CID 89094397
sulfanyl 3-(7-tert-butyl-2-carbamoyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinolin-3-yl)benzoate (PubChem CID 89094397) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is sulfanyl 3-(7-tert-butyl-2-carbamoyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinolin-3-yl)benzoate.
| Compound Name | sulfanyl 3-(7-tert-butyl-2-carbamoyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinolin-3-yl)benzoate |
|---|---|
| PubChem CID | 89094397 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | sulfanyl 3-(7-tert-butyl-2-carbamoyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinolin-3-yl)benzoate |
| SMILES | CC(C)(C)C1CCc2nc3c(-c4cccc(C(=O)OS)c4)c(C(N)=O)[nH]c3cc2C1 |
| InChI | InChI=1S/C23H25N3O3S/c1-23(2,3)15-7-8-16-14(10-15)11-17-19(25-16)18(20(26-17)21(24)27)12-5-4-6-13(9-12)22(28)29-30/h4-6,9,11,15,26,30H,7-8,10H2,1-3H3,(H2,24,27) |
| InChIKey | OFAGZNXKIUYULY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|