C16H27BO3 — CID 89094625
4,4,5,5-tetramethyl-2-[4-(5-methyl-3,4-dihydro-2H-pyran-6-yl)but-1-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 89094625) has the molecular formula C16H27BO3 and a molecular weight of 278.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-(5-methyl-3,4-dihydro-2H-pyran-6-yl)but-1-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-(5-methyl-3,4-dihydro-2H-pyran-6-yl)but-1-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 89094625 |
| Molecular Formula | C16H27BO3 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-(5-methyl-3,4-dihydro-2H-pyran-6-yl)but-1-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | C=C(CCC1=C(C)CCCO1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H27BO3/c1-12-8-7-11-18-14(12)10-9-13(2)17-19-15(3,4)16(5,6)20-17/h2,7-11H2,1,3-6H3 |
| InChIKey | HZPIVYYJHRBNSL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|