C20H20F3N3O3S — CID 89094861
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,4-difluorobenzamide (PubChem CID 89094861) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 89094861 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-2,4-difluorobenzamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)c3ccc(F)cc3F)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C20H20F3N3O3S/c1-19(2)18(24)26-20(3,10-30(19,28)29)14-9-12(5-7-15(14)22)25-17(27)13-6-4-11(21)8-16(13)23/h4-9H,10H2,1-3H3,(H2,24,26)(H,25,27)/t20-/m0/s1 |
| InChIKey | SKJAYJDIZAUBDV-FQEVSTJZSA-N |
| XLogP | 3.14 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |