C12H15F2NOS — CID 89094867
(NE,S)-N-[1-(2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 89094867) has the molecular formula C12H15F2NOS and a molecular weight of 259.32 g/mol. Its IUPAC name is (NE,S)-N-[1-(2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[1-(2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 89094867 |
| Molecular Formula | C12H15F2NOS |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (NE,S)-N-[1-(2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(=N\[S@@](=O)C(C)(C)C)c1c(F)cccc1F |
| InChI | InChI=1S/C12H15F2NOS/c1-8(15-17(16)12(2,3)4)11-9(13)6-5-7-10(11)14/h5-7H,1-4H3/b15-8+/t17-/m0/s1 |
| InChIKey | RURBDLLLUSOTCS-BXUGYJKXSA-N |
| XLogP | 3.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|