C19H17F4N3O2S2 — CID 89094909
3-[5-[(3S,6S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]benzonitrile (PubChem CID 89094909) has the molecular formula C19H17F4N3O2S2 and a molecular weight of 459.49 g/mol. Its IUPAC name is 3-[5-[(3S,6S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]benzonitrile.
| Compound Name | 3-[5-[(3S,6S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 89094909 |
| Molecular Formula | C19H17F4N3O2S2 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 3-[5-[(3S,6S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]benzonitrile |
| SMILES | C[C@]1(CC(F)(F)F)C(N)=N[C@](C)(c2sc(-c3cccc(C#N)c3)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H17F4N3O2S2/c1-17(10-30(27,28)18(2,16(25)26-17)9-19(21,22)23)15-13(20)7-14(29-15)12-5-3-4-11(6-12)8-24/h3-7H,9-10H2,1-2H3,(H2,25,26)/t17-,18-/m0/s1 |
| InChIKey | XQOLXJKJFXAENW-ROUUACIJSA-N |
| XLogP | 4.14 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |