C16H18F5N3O3S — CID 89094946
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-3,3,3-trifluoropropanamide (PubChem CID 89094946) has the molecular formula C16H18F5N3O3S and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 89094946 |
| Molecular Formula | C16H18F5N3O3S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-3,3,3-trifluoropropanamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)CC(F)(F)F)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C16H18F5N3O3S/c1-14(2)13(22)24-15(3,7-28(14,26)27)9-4-8(5-10(17)12(9)18)23-11(25)6-16(19,20)21/h4-5H,6-7H2,1-3H3,(H2,22,24)(H,23,25)/t15-/m0/s1 |
| InChIKey | FSJATKPMYQTPNW-HNNXBMFYSA-N |
| XLogP | 2.64 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |