C15H17F4N3O3S — CID 89094947
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluoroacetamide (PubChem CID 89094947) has the molecular formula C15H17F4N3O3S and a molecular weight of 395.38 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluoroacetamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 89094947 |
| Molecular Formula | C15H17F4N3O3S |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2,2-difluoroacetamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)C(F)F)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C15H17F4N3O3S/c1-14(2)13(20)22-15(3,6-26(14,24)25)8-4-7(5-9(16)10(8)17)21-12(23)11(18)19/h4-5,11H,6H2,1-3H3,(H2,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | GROCMHLUXPORAE-HNNXBMFYSA-N |
| XLogP | 1.95 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |