C18H23F2N3O3S — CID 89094953
N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-cyclopropylacetamide (PubChem CID 89094953) has the molecular formula C18H23F2N3O3S and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-cyclopropylacetamide.
| Compound Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-cyclopropylacetamide |
|---|---|
| PubChem CID | 89094953 |
| Molecular Formula | C18H23F2N3O3S |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4,5-difluorophenyl]-2-cyclopropylacetamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)CC3CC3)cc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C18H23F2N3O3S/c1-17(2)16(21)23-18(3,9-27(17,25)26)12-7-11(8-13(19)15(12)20)22-14(24)6-10-4-5-10/h7-8,10H,4-6,9H2,1-3H3,(H2,21,23)(H,22,24)/t18-/m0/s1 |
| InChIKey | QVYWFJDBOFQKMZ-SFHVURJKSA-N |
| XLogP | 2.48 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |