C13H18FN3O2S — CID 89095033
(5R)-5-(5-amino-2-fluorophenyl)-2-ethyl-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine (PubChem CID 89095033) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is (5R)-5-(5-amino-2-fluorophenyl)-2-ethyl-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine.
| Compound Name | (5R)-5-(5-amino-2-fluorophenyl)-2-ethyl-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine |
|---|---|
| PubChem CID | 89095033 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (5R)-5-(5-amino-2-fluorophenyl)-2-ethyl-5-methyl-1,1-dioxo-2,6-dihydro-1,4-thiazin-3-amine |
| SMILES | CCC1C(N)=N[C@](C)(c2cc(N)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C13H18FN3O2S/c1-3-11-12(16)17-13(2,7-20(11,18)19)9-6-8(15)4-5-10(9)14/h4-6,11H,3,7,15H2,1-2H3,(H2,16,17)/t11?,13-/m0/s1 |
| InChIKey | GZJGNNHEKLJTEN-YUZLPWPTSA-N |
| XLogP | 1.19 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|