C19H20F3N5O2S — CID 89095041
N'-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-3,5-difluoropyridine-2-carboximidamide (PubChem CID 89095041) has the molecular formula C19H20F3N5O2S and a molecular weight of 439.46 g/mol. Its IUPAC name is N'-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-3,5-difluoropyridine-2-carboximidamide.
| Compound Name | N'-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-3,5-difluoropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 89095041 |
| Molecular Formula | C19H20F3N5O2S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N'-[3-[(3R)-5-amino-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-3,5-difluoropyridine-2-carboximidamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(/N=C(\N)c3ncc(F)cc3F)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H20F3N5O2S/c1-18(2)17(24)27-19(3,9-30(18,28)29)12-7-11(4-5-13(12)21)26-16(23)15-14(22)6-10(20)8-25-15/h4-8H,9H2,1-3H3,(H2,23,26)(H2,24,27)/t19-/m0/s1 |
| InChIKey | XANOCHKJRHQOAR-IBGZPJMESA-N |
| XLogP | 2.32 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|