C19H17F4N3O4S — CID 89095125
(3R,6R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine (PubChem CID 89095125) has the molecular formula C19H17F4N3O4S and a molecular weight of 459.42 g/mol. Its IUPAC name is (3R,6R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095125 |
| Molecular Formula | C19H17F4N3O4S |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | (3R,6R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine |
| SMILES | C[C@@]1(c2cccc(C(F)(F)F)c2)C(N)=N[C@](C)(c2cc([N+](=O)[O-])ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H17F4N3O4S/c1-17(14-9-13(26(27)28)6-7-15(14)20)10-31(29,30)18(2,16(24)25-17)11-4-3-5-12(8-11)19(21,22)23/h3-9H,10H2,1-2H3,(H2,24,25)/t17-,18+/m0/s1 |
| InChIKey | OKDPMVFWWHMBJV-ZWKOTPCHSA-N |
| XLogP | 3.67 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|