C23H21ClFN5O3S2 — CID 89095141
(3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine (PubChem CID 89095141) has the molecular formula C23H21ClFN5O3S2 and a molecular weight of 534.04 g/mol. Its IUPAC name is (3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine.
| Compound Name | (3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095141 |
| Molecular Formula | C23H21ClFN5O3S2 |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine |
| SMILES | C[C@@]1(C2SC(c3nnc(-c4ccc(Cl)cc4)o3)=CC2F)CS(=O)(=O)[C@@](C)(c2ccccn2)C(N)=N1 |
| InChI | InChI=1S/C23H21ClFN5O3S2/c1-22(12-35(31,32)23(2,21(26)28-22)17-5-3-4-10-27-17)18-15(25)11-16(34-18)20-30-29-19(33-20)13-6-8-14(24)9-7-13/h3-11,15,18H,12H2,1-2H3,(H2,26,28)/t15?,18?,22-,23-/m0/s1 |
| InChIKey | OVHCYQBQBQJXHG-SELMJZEFSA-N |
| XLogP | 4.04 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |