C12H13BrF4N2O2S2 — CID 89095145
(3S,6S)-3-(5-bromo-3-fluorothiophen-2-yl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine (PubChem CID 89095145) has the molecular formula C12H13BrF4N2O2S2 and a molecular weight of 437.28 g/mol. Its IUPAC name is (3S,6S)-3-(5-bromo-3-fluorothiophen-2-yl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3S,6S)-3-(5-bromo-3-fluorothiophen-2-yl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095145 |
| Molecular Formula | C12H13BrF4N2O2S2 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | (3S,6S)-3-(5-bromo-3-fluorothiophen-2-yl)-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
| SMILES | C[C@]1(CC(F)(F)F)C(N)=N[C@](C)(c2sc(Br)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C12H13BrF4N2O2S2/c1-10(8-6(14)3-7(13)22-8)5-23(20,21)11(2,9(18)19-10)4-12(15,16)17/h3H,4-5H2,1-2H3,(H2,18,19)/t10-,11-/m0/s1 |
| InChIKey | YAKLFPOGXMYXCU-QWRGUYRKSA-N |
| XLogP | 3.36 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |