C18H19F2N3O2S — CID 89095147
(3R,6S)-3-(5-amino-2-fluorophenyl)-6-(3-fluorophenyl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 89095147) has the molecular formula C18H19F2N3O2S and a molecular weight of 379.43 g/mol. Its IUPAC name is (3R,6S)-3-(5-amino-2-fluorophenyl)-6-(3-fluorophenyl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-6-(3-fluorophenyl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095147 |
| Molecular Formula | C18H19F2N3O2S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-6-(3-fluorophenyl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)CS(=O)(=O)[C@@](C)(c2cccc(F)c2)C(N)=N1 |
| InChI | InChI=1S/C18H19F2N3O2S/c1-17(14-9-13(21)6-7-15(14)20)10-26(24,25)18(2,16(22)23-17)11-4-3-5-12(19)8-11/h3-9H,10,21H2,1-2H3,(H2,22,23)/t17-,18-/m0/s1 |
| InChIKey | RLLHTXUBBDTSAX-ROUUACIJSA-N |
| XLogP | 2.46 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|