C17H18ClN5O2S2 — CID 89095152
(3S)-3-[3-chloro-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 89095152) has the molecular formula C17H18ClN5O2S2 and a molecular weight of 423.95 g/mol. Its IUPAC name is (3S)-3-[3-chloro-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-chloro-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095152 |
| Molecular Formula | C17H18ClN5O2S2 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | (3S)-3-[3-chloro-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2sc(-c3ccc4ncnn4c3)cc2Cl)CS1(=O)=O |
| InChI | InChI=1S/C17H18ClN5O2S2/c1-16(2)15(19)22-17(3,8-27(16,24)25)14-11(18)6-12(26-14)10-4-5-13-20-9-21-23(13)7-10/h4-7,9H,8H2,1-3H3,(H2,19,22)/t17-/m0/s1 |
| InChIKey | SGFXQLMACYUJBA-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |