C18H21F4N3O3S2 — CID 89095153
(3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine (PubChem CID 89095153) has the molecular formula C18H21F4N3O3S2 and a molecular weight of 467.51 g/mol. Its IUPAC name is (3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095153 |
| Molecular Formula | C18H21F4N3O3S2 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (3S)-3-[3-fluoro-5-(5-methoxy-3-pyridinyl)-2,3-dihydrothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
| SMILES | COc1cncc(C2=CC(F)C([C@]3(C)CS(=O)(=O)C(C)(CC(F)(F)F)C(N)=N3)S2)c1 |
| InChI | InChI=1S/C18H21F4N3O3S2/c1-16(9-30(26,27)17(2,15(23)25-16)8-18(20,21)22)14-12(19)5-13(29-14)10-4-11(28-3)7-24-6-10/h4-7,12,14H,8-9H2,1-3H3,(H2,23,25)/t12?,14?,16-,17?/m0/s1 |
| InChIKey | ZHHGHGSCDUVPAQ-IVJDQLEISA-N |
| XLogP | 3.14 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |