C19H20N4O3S2 — CID 89095154
(3S)-3,6,6-trimethyl-3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 89095154) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is (3S)-3,6,6-trimethyl-3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3,6,6-trimethyl-3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095154 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (3S)-3,6,6-trimethyl-3-[4-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(-c3cccc(-c4nnco4)c3)cs2)CS1(=O)=O |
| InChI | InChI=1S/C19H20N4O3S2/c1-18(2)17(20)22-19(3,10-28(18,24)25)15-8-14(9-27-15)12-5-4-6-13(7-12)16-23-21-11-26-16/h4-9,11H,10H2,1-3H3,(H2,20,22)/t19-/m0/s1 |
| InChIKey | RPWIOZZDPSZHDG-IBGZPJMESA-N |
| XLogP | 3.24 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |