C17H19FN4O2S — CID 89095252
(3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine (PubChem CID 89095252) has the molecular formula C17H19FN4O2S and a molecular weight of 362.43 g/mol. Its IUPAC name is (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095252 |
| Molecular Formula | C17H19FN4O2S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (3R,6S)-3-(5-amino-2-fluorophenyl)-3,6-dimethyl-1,1-dioxo-6-pyridin-2-yl-2H-1,4-thiazin-5-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)CS(=O)(=O)[C@@](C)(c2ccccn2)C(N)=N1 |
| InChI | InChI=1S/C17H19FN4O2S/c1-16(12-9-11(19)6-7-13(12)18)10-25(23,24)17(2,15(20)22-16)14-5-3-4-8-21-14/h3-9H,10,19H2,1-2H3,(H2,20,22)/t16-,17-/m0/s1 |
| InChIKey | SBGZFDSPMSADCQ-IRXDYDNUSA-N |
| XLogP | 1.72 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|