C19H17F5N2O2S — CID 89095402
(3R,6S)-3-(2,4-difluorophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine (PubChem CID 89095402) has the molecular formula C19H17F5N2O2S and a molecular weight of 432.41 g/mol. Its IUPAC name is (3R,6S)-3-(2,4-difluorophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-(2,4-difluorophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095402 |
| Molecular Formula | C19H17F5N2O2S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (3R,6S)-3-(2,4-difluorophenyl)-3,6-dimethyl-1,1-dioxo-6-[3-(trifluoromethyl)phenyl]-2H-1,4-thiazin-5-amine |
| SMILES | C[C@@]1(c2ccc(F)cc2F)CS(=O)(=O)[C@@](C)(c2cccc(C(F)(F)F)c2)C(N)=N1 |
| InChI | InChI=1S/C19H17F5N2O2S/c1-17(14-7-6-13(20)9-15(14)21)10-29(27,28)18(2,16(25)26-17)11-4-3-5-12(8-11)19(22,23)24/h3-9H,10H2,1-2H3,(H2,25,26)/t17-,18-/m0/s1 |
| InChIKey | DPSKZHWZWPCSEG-ROUUACIJSA-N |
| XLogP | 3.90 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |