C20H19F2N3O2S — CID 89095425
3-[3-fluoro-6-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 89095425) has the molecular formula C20H19F2N3O2S and a molecular weight of 403.45 g/mol. Its IUPAC name is 3-[3-fluoro-6-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | 3-[3-fluoro-6-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095425 |
| Molecular Formula | C20H19F2N3O2S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-[3-fluoro-6-[2-(4-fluorophenyl)ethynyl]-2-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(c2nc(C#Cc3ccc(F)cc3)ccc2F)CS(=O)(=O)C(C)(C)C(N)=N1 |
| InChI | InChI=1S/C20H19F2N3O2S/c1-19(2)18(23)25-20(3,12-28(19,26)27)17-16(22)11-10-15(24-17)9-6-13-4-7-14(21)8-5-13/h4-5,7-8,10-11H,12H2,1-3H3,(H2,23,25) |
| InChIKey | SECNHBCABZATFC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|