C13H15F3N2O2S — CID 89095533
(3R)-3,6,6-trimethyl-1,1-dioxo-3-(2,3,6-trifluorophenyl)-2H-1,4-thiazin-5-amine (PubChem CID 89095533) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is (3R)-3,6,6-trimethyl-1,1-dioxo-3-(2,3,6-trifluorophenyl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3,6,6-trimethyl-1,1-dioxo-3-(2,3,6-trifluorophenyl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 89095533 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (3R)-3,6,6-trimethyl-1,1-dioxo-3-(2,3,6-trifluorophenyl)-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2c(F)ccc(F)c2F)CS1(=O)=O |
| InChI | InChI=1S/C13H15F3N2O2S/c1-12(2)11(17)18-13(3,6-21(12,19)20)9-7(14)4-5-8(15)10(9)16/h4-5H,6H2,1-3H3,(H2,17,18)/t13-/m0/s1 |
| InChIKey | RIRNSBITCCISLU-ZDUSSCGKSA-N |
| XLogP | 1.88 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|