About 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione
5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 89095634) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
Molecular Properties
| Compound Name | 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| PubChem CID | 89095634 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | [H]/N=C/C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C8H9NO4/c1-8(2)12-6(10)5(3-4-9)7(11)13-8/h3-4,9H,1-2H3/b9-4+ |
| InChIKey | KNQHOMPGAGYGHE-RUDMXATFSA-N |
| XLogP | 0.40 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
The IUPAC name of 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CID 89095634) is 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
What is the SMILES notation for 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
The canonical SMILES for 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione is [H]/N=C/C=C1C(=O)OC(C)(C)OC1=O.
What is the InChIKey of 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
The InChIKey is KNQHOMPGAGYGHE-RUDMXATFSA-N. The full InChI is InChI=1S/C8H9NO4/c1-8(2)12-6(10)5(3-4-9)7(11)13-8/h3-4,9H,1-2H3/b9-4+.
What are the key properties of 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione?
5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione has a molecular weight of 183.16 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-iminoethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione is sourced from PubChem (CID 89095634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).