About 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole
6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole (PubChem CID 89095932) has the molecular formula C7H8FNO
and a molecular weight of 141.14 g/mol. Its IUPAC name is 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole.
Molecular Properties
| Compound Name | 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole |
| PubChem CID | 89095932 |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole |
| SMILES | Cc1noc2c1CCC2F |
| InChI | InChI=1S/C7H8FNO/c1-4-5-2-3-6(8)7(5)10-9-4/h6H,2-3H2,1H3 |
| InChIKey | RXDLDLFSJJHNNL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole?
The IUPAC name of 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole (CID 89095932) is 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole.
What is the SMILES notation for 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole?
The canonical SMILES for 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole is Cc1noc2c1CCC2F.
What is the InChIKey of 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole?
The InChIKey is RXDLDLFSJJHNNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO/c1-4-5-2-3-6(8)7(5)10-9-4/h6H,2-3H2,1H3.
What are the key properties of 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole?
6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole has a molecular weight of 141.14 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-methyl-5,6-dihydro-4H-cyclopenta[d][1,2]oxazole is sourced from PubChem (CID 89095932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).