C22H31FN2O4Si — CID 89095953
(4S)-3-[(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 89095953) has the molecular formula C22H31FN2O4Si and a molecular weight of 434.58 g/mol. Its IUPAC name is (4S)-3-[(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89095953 |
| Molecular Formula | C22H31FN2O4Si |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (4S)-3-[(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C#CCC[C@@H](C(=O)N1C(=O)OC[C@@H]1C)[C@H](O[Si](C)(C)C(C)(C)C)c1cncc(F)c1 |
| InChI | InChI=1S/C22H31FN2O4Si/c1-8-9-10-18(20(26)25-15(2)14-28-21(25)27)19(16-11-17(23)13-24-12-16)29-30(6,7)22(3,4)5/h1,11-13,15,18-19H,9-10,14H2,2-7H3/t15-,18+,19+/m0/s1 |
| InChIKey | AFKNSOJSYGCJAW-KFKAGJAMSA-N |
| XLogP | 4.68 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|