C23H30N4O5S2 — CID 89096001
(Z)-6-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]hex-4-enal (PubChem CID 89096001) has the molecular formula C23H30N4O5S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is (Z)-6-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]hex-4-enal.
| Compound Name | (Z)-6-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]hex-4-enal |
|---|---|
| PubChem CID | 89096001 |
| Molecular Formula | C23H30N4O5S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | (Z)-6-[(5R,8S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]hex-4-enal |
| SMILES | CC(C)[C@@H]1NC(=O)[C@]2(C)CSC(=N2)c2csc(n2)CNC(=O)CC(C/C=C\CCC=O)OC1=O |
| InChI | InChI=1S/C23H30N4O5S2/c1-14(2)19-21(30)32-15(8-6-4-5-7-9-28)10-17(29)24-11-18-25-16(12-33-18)20-27-23(3,13-34-20)22(31)26-19/h4,6,9,12,14-15,19H,5,7-8,10-11,13H2,1-3H3,(H,24,29)(H,26,31)/b6-4-/t15?,19-,23-/m0/s1 |
| InChIKey | VOKGPSUVSGQNQX-ARXAVJORSA-N |
| XLogP | 2.39 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|