C15H20FNO — CID 89096563
(3S,4S)-4-[(1Z)-3-fluoro-1-(3-methylfuran-2-yl)buta-1,3-dienyl]-3-methylpiperidine (PubChem CID 89096563) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is (3S,4S)-4-[(1Z)-3-fluoro-1-(3-methylfuran-2-yl)buta-1,3-dienyl]-3-methylpiperidine.
| Compound Name | (3S,4S)-4-[(1Z)-3-fluoro-1-(3-methylfuran-2-yl)buta-1,3-dienyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 89096563 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (3S,4S)-4-[(1Z)-3-fluoro-1-(3-methylfuran-2-yl)buta-1,3-dienyl]-3-methylpiperidine |
| SMILES | C=C(F)/C=C(\c1occc1C)[C@H]1CCNC[C@H]1C |
| InChI | InChI=1S/C15H20FNO/c1-10-5-7-18-15(10)14(8-12(3)16)13-4-6-17-9-11(13)2/h5,7-8,11,13,17H,3-4,6,9H2,1-2H3/b14-8-/t11-,13+/m1/s1 |
| InChIKey | PMNFXTBFARXHNK-HRQBQTGPSA-N |
| XLogP | 3.70 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|