C21H44O5Si2 — CID 89096983
(3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-prop-2-enyloxolan-3-ol (PubChem CID 89096983) has the molecular formula C21H44O5Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-prop-2-enyloxolan-3-ol.
| Compound Name | (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 89096983 |
| Molecular Formula | C21H44O5Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@]1(O)C(OC)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O5Si2/c1-13-14-21(22)17(26-28(11,12)20(5,6)7)16(25-18(21)23-8)15-24-27(9,10)19(2,3)4/h13,16-18,22H,1,14-15H2,2-12H3/t16-,17-,18?,21-/m1/s1 |
| InChIKey | HCEIKVMAWCKVCS-WXIGMUJPSA-N |
| XLogP | 5.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|