About N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine
N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine (PubChem CID 89097031) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine |
| PubChem CID | 89097031 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine |
| SMILES | C/N=C1\SCCN1C(C)C |
| InChI | InChI=1S/C7H14N2S/c1-6(2)9-4-5-10-7(9)8-3/h6H,4-5H2,1-3H3/b8-7- |
| InChIKey | OABNLGAMCQYTIL-FPLPWBNLSA-N |
| XLogP | 1.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine?
The IUPAC name of N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine (CID 89097031) is N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine.
What is the SMILES notation for N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine?
The canonical SMILES for N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine is C/N=C1\SCCN1C(C)C.
What is the InChIKey of N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine?
The InChIKey is OABNLGAMCQYTIL-FPLPWBNLSA-N. The full InChI is InChI=1S/C7H14N2S/c1-6(2)9-4-5-10-7(9)8-3/h6H,4-5H2,1-3H3/b8-7-.
What are the key properties of N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine?
N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine has a molecular weight of 158.27 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-propan-2-yl-1,3-thiazolidin-2-imine is sourced from PubChem (CID 89097031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).